C23H27ClFN3O3S — CID 162325660
(1,1-dioxo-1,4-thiazinan-4-yl)-[3-(4-fluoro-3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride (PubChem CID 162325660) has the molecular formula C23H27ClFN3O3S and a molecular weight of 480.01 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(4-fluoro-3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(4-fluoro-3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 162325660 |
| Molecular Formula | C23H27ClFN3O3S |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(4-fluoro-3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride |
| SMILES | Cc1cc(Nc2ncc(C(=O)N3CCS(=O)(=O)CC3)c3c2C2CCC3CC2)ccc1F.Cl |
| InChI | InChI=1S/C23H26FN3O3S.ClH/c1-14-12-17(6-7-19(14)24)26-22-21-16-4-2-15(3-5-16)20(21)18(13-25-22)23(28)27-8-10-31(29,30)11-9-27;/h6-7,12-13,15-16H,2-5,8-11H2,1H3,(H,25,26);1H |
| InChIKey | ZIDFZRNYSBUTLU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |