C23H28ClN3O3S — CID 162325676
(1,1-dioxo-1,4-thiazinan-4-yl)-[3-(3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride (PubChem CID 162325676) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 162325676 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-(3-methylanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]methanone;hydrochloride |
| SMILES | Cc1cccc(Nc2ncc(C(=O)N3CCS(=O)(=O)CC3)c3c2C2CCC3CC2)c1.Cl |
| InChI | InChI=1S/C23H27N3O3S.ClH/c1-15-3-2-4-18(13-15)25-22-21-17-7-5-16(6-8-17)20(21)19(14-24-22)23(27)26-9-11-30(28,29)12-10-26;/h2-4,13-14,16-17H,5-12H2,1H3,(H,24,25);1H |
| InChIKey | GXSZJPGLYJPZSL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |