C22H24Cl3N3O3S — CID 161326320
[3-(3,5-dichloroanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone;hydrochloride (PubChem CID 161326320) has the molecular formula C22H24Cl3N3O3S and a molecular weight of 516.88 g/mol. Its IUPAC name is [3-(3,5-dichloroanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone;hydrochloride.
| Compound Name | [3-(3,5-dichloroanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 161326320 |
| Molecular Formula | C22H24Cl3N3O3S |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | [3-(3,5-dichloroanilino)-4-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-6-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cnc(Nc2cc(Cl)cc(Cl)c2)c2c1C1CCC2CC1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O3S.ClH/c23-15-9-16(24)11-17(10-15)26-21-20-14-3-1-13(2-4-14)19(20)18(12-25-21)22(28)27-5-7-31(29,30)8-6-27;/h9-14H,1-8H2,(H,25,26);1H |
| InChIKey | NLTAHWSQVIOONZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |