C22H24N2O2 — CID 56651463
4,8-bis(hex-1-ynyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole (PubChem CID 56651463) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4,8-bis(hex-1-ynyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole.
| Compound Name | 4,8-bis(hex-1-ynyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 56651463 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4,8-bis(hex-1-ynyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| SMILES | CCCCC#Cc1c2nc(C)oc2c(C#CCCCC)c2nc(C)oc12 |
| InChI | InChI=1S/C22H24N2O2/c1-5-7-9-11-13-17-19-22(26-15(3)23-19)18(14-12-10-8-6-2)20-21(17)25-16(4)24-20/h5-10H2,1-4H3 |
| InChIKey | DOIZWIYUCSWBBZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|