C21H36N2O4 — CID 56652236
(14Z,16Z)-14,17-dimethyl-1,7-dioxa-15,16-diazacyclotricosa-14,16-diene-2,6-dione (PubChem CID 56652236) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is (14Z,16Z)-14,17-dimethyl-1,7-dioxa-15,16-diazacyclotricosa-14,16-diene-2,6-dione.
| Compound Name | (14Z,16Z)-14,17-dimethyl-1,7-dioxa-15,16-diazacyclotricosa-14,16-diene-2,6-dione |
|---|---|
| PubChem CID | 56652236 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (14Z,16Z)-14,17-dimethyl-1,7-dioxa-15,16-diazacyclotricosa-14,16-diene-2,6-dione |
| SMILES | C/C1=N/N=C(/C)CCCCCCOC(=O)CCCC(=O)OCCCCCC1 |
| InChI | InChI=1S/C21H36N2O4/c1-18-12-7-3-5-9-16-26-20(24)14-11-15-21(25)27-17-10-6-4-8-13-19(2)23-22-18/h3-17H2,1-2H3/b22-18-,23-19- |
| InChIKey | PMJJKZHXZAWECU-RSFSRFMPSA-N |
| XLogP | 4.99 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |