C30H45ClO3 — CID 56653405
(3R,4R,6aS,6bR,8aR,11R,12S,14bS)-14-chloro-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a-dodecahydro-1H-picene-4-carboxylic acid (PubChem CID 56653405) has the molecular formula C30H45ClO3 and a molecular weight of 489.14 g/mol. Its IUPAC name is (3R,4R,6aS,6bR,8aR,11R,12S,14bS)-14-chloro-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a-dodecahydro-1H-picene-4-carboxylic acid.
| Compound Name | (3R,4R,6aS,6bR,8aR,11R,12S,14bS)-14-chloro-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a-dodecahydro-1H-picene-4-carboxylic acid |
|---|---|
| PubChem CID | 56653405 |
| Molecular Formula | C30H45ClO3 |
| Molecular Weight | 489.14 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (3R,4R,6aS,6bR,8aR,11R,12S,14bS)-14-chloro-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a-dodecahydro-1H-picene-4-carboxylic acid |
| SMILES | C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC(Cl)=C4[C@@]5(C)CC[C@@H](O)[C@](C)(C(=O)O)C5CC[C@]43C)C2[C@H]1C |
| InChI | InChI=1S/C30H45ClO3/c1-17-8-11-26(3)14-15-28(5)19(23(26)18(17)2)16-20(31)24-27(4)12-10-22(32)30(7,25(33)34)21(27)9-13-29(24,28)6/h16-18,21-23,32H,8-15H2,1-7H3,(H,33,34)/t17-,18+,21?,22-,23?,26-,27+,28-,29-,30-/m1/s1 |
| InChIKey | XBABVNCJODTURK-AHIULAKASA-N |
| XLogP | 7.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.14 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |