C27H37NO5Si — CID 56654261
2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 56654261) has the molecular formula C27H37NO5Si and a molecular weight of 483.68 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 56654261 |
| Molecular Formula | C27H37NO5Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C=C(COC(=O)CNC(=O)OC(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H37NO5Si/c1-21(19-31-24(29)18-28-25(30)33-26(2,3)4)20-32-34(27(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17H,1,18-20H2,2-7H3,(H,28,30) |
| InChIKey | HJQXMNJQPUBBAN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|