C27H41FN2O2 — CID 56654683
(3E,10R,13S)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 56654683) has the molecular formula C27H41FN2O2 and a molecular weight of 444.64 g/mol. Its IUPAC name is (3E,10R,13S)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3E,10R,13S)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 56654683 |
| Molecular Formula | C27H41FN2O2 |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (3E,10R,13S)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=C1CC2C(CC[C@]3(C)C(=O)C(F)CC23)[C@@]2(C)CC/C(=N\OCCN3CCCCC3)CC12 |
| InChI | InChI=1S/C27H41FN2O2/c1-18-15-20-21(8-10-27(3)23(20)17-24(28)25(27)31)26(2)9-7-19(16-22(18)26)29-32-14-13-30-11-5-4-6-12-30/h20-24H,1,4-17H2,2-3H3/b29-19+/t20?,21?,22?,23?,24?,26-,27+/m1/s1 |
| InChIKey | UNNGZEYDEGXUPN-WJNZPVFLSA-N |
| XLogP | 5.57 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|