C27H42FN2O2+ — CID 140621046
(5R,10R,13S,16R)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ium-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 140621046) has the molecular formula C27H42FN2O2+ and a molecular weight of 445.64 g/mol. Its IUPAC name is (5R,10R,13S,16R)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ium-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (5R,10R,13S,16R)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ium-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 140621046 |
| Molecular Formula | C27H42FN2O2+ |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (5R,10R,13S,16R)-16-fluoro-10,13-dimethyl-6-methylidene-3-(2-piperidin-1-ium-1-ylethoxyimino)-1,2,4,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C=C1CC2C3C[C@@H](F)C(=O)[C@@]3(C)CCC2[C@@]2(C)CCC(=NOCC[NH+]3CCCCC3)C[C@H]12 |
| InChI | InChI=1S/C27H41FN2O2/c1-18-15-20-21(8-10-27(3)23(20)17-24(28)25(27)31)26(2)9-7-19(16-22(18)26)29-32-14-13-30-11-5-4-6-12-30/h20-24H,1,4-17H2,2-3H3/p+1/t20?,21?,22-,23?,24-,26-,27+/m1/s1 |
| InChIKey | UNNGZEYDEGXUPN-OCCWLELISA-O |
| XLogP | 4.15 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|