C22H34N2O3 — CID 167165586
2-[(E)-[(5S,8R,9S,10S,13S,14S)-10,13,16-trimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetamide (PubChem CID 167165586) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[(E)-[(5S,8R,9S,10S,13S,14S)-10,13,16-trimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetamide.
| Compound Name | 2-[(E)-[(5S,8R,9S,10S,13S,14S)-10,13,16-trimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 167165586 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 2-[(E)-[(5S,8R,9S,10S,13S,14S)-10,13,16-trimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-ylidene]amino]oxyacetamide |
| SMILES | CC1C[C@H]2[C@@H]3CC[C@H]4C/C(=N/OCC(N)=O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C22H34N2O3/c1-13-10-18-16-5-4-14-11-15(24-27-12-19(23)25)6-8-21(14,2)17(16)7-9-22(18,3)20(13)26/h13-14,16-18H,4-12H2,1-3H3,(H2,23,25)/b24-15+/t13?,14-,16+,17-,18-,21-,22-/m0/s1 |
| InChIKey | KUPKQZVPHZODCX-WRWHJVKNSA-N |
| XLogP | 3.70 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|