C18H15ClO — CID 56655958
6-chloro-3-[(E)-3-phenylprop-1-enyl]-2H-chromene (PubChem CID 56655958) has the molecular formula C18H15ClO and a molecular weight of 282.77 g/mol. Its IUPAC name is 6-chloro-3-[(E)-3-phenylprop-1-enyl]-2H-chromene.
| Compound Name | 6-chloro-3-[(E)-3-phenylprop-1-enyl]-2H-chromene |
|---|---|
| PubChem CID | 56655958 |
| Molecular Formula | C18H15ClO |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-chloro-3-[(E)-3-phenylprop-1-enyl]-2H-chromene |
| SMILES | Clc1ccc2c(c1)C=C(/C=C/Cc1ccccc1)CO2 |
| InChI | InChI=1S/C18H15ClO/c19-17-9-10-18-16(12-17)11-15(13-20-18)8-4-7-14-5-2-1-3-6-14/h1-6,8-12H,7,13H2/b8-4+ |
| InChIKey | SOUPDMSMHZUOGE-XBXARRHUSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |