C23H26FN5O2 — CID 56656094
1-[6-cyclohexyl-4-(4-fluoropiperidin-1-yl)quinazolin-2-yl]pyrazole-4-carboxylic acid (PubChem CID 56656094) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 1-[6-cyclohexyl-4-(4-fluoropiperidin-1-yl)quinazolin-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[6-cyclohexyl-4-(4-fluoropiperidin-1-yl)quinazolin-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56656094 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-[6-cyclohexyl-4-(4-fluoropiperidin-1-yl)quinazolin-2-yl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2nc(N3CCC(F)CC3)c3cc(C4CCCCC4)ccc3n2)c1 |
| InChI | InChI=1S/C23H26FN5O2/c24-18-8-10-28(11-9-18)21-19-12-16(15-4-2-1-3-5-15)6-7-20(19)26-23(27-21)29-14-17(13-25-29)22(30)31/h6-7,12-15,18H,1-5,8-11H2,(H,30,31) |
| InChIKey | HHPHETPBBAFFHL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |