C22H22N4O — CID 56657910
4-[[4-[(4-tert-butylphenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 56657910) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 4-[[4-[(4-tert-butylphenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(4-tert-butylphenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 56657910 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-[[4-[(4-tert-butylphenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | CC(C)(C)c1ccc(C(O)c2ccnc(Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C22H22N4O/c1-22(2,3)17-8-6-16(7-9-17)20(27)19-12-13-24-21(26-19)25-18-10-4-15(14-23)5-11-18/h4-13,20,27H,1-3H3,(H,24,25,26) |
| InChIKey | BDTLNKPYNNCQEK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |