C23H28F3N3O2 — CID 56658782
tert-butyl N-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate (PubChem CID 56658782) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is tert-butyl N-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 56658782 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | tert-butyl N-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(c2ccc(C(F)(F)F)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C23H28F3N3O2/c1-22(2,3)31-21(30)28-19-10-13-29(14-11-19)20(17-5-4-12-27-15-17)16-6-8-18(9-7-16)23(24,25)26/h4-9,12,15,19-20H,10-11,13-14H2,1-3H3,(H,28,30) |
| InChIKey | GUGSPZGZKPVEFS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |