C21H22N4O2 — CID 56658896
2-(2,3-dimethylphenoxy)-N'-hydroxy-N-methyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide (PubChem CID 56658896) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N'-hydroxy-N-methyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N'-hydroxy-N-methyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56658896 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N'-hydroxy-N-methyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide |
| SMILES | Cc1cccc(Oc2ncccc2/C(=N/O)N(C)Cc2cccnc2)c1C |
| InChI | InChI=1S/C21H22N4O2/c1-15-7-4-10-19(16(15)2)27-21-18(9-6-12-23-21)20(24-26)25(3)14-17-8-5-11-22-13-17/h4-13,26H,14H2,1-3H3/b24-20- |
| InChIKey | ITDSJXFDNADTDV-GFMRDNFCSA-N |
| XLogP | 4.15 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|