C21H21FN4O2 — CID 56665295
2-[(2-fluorophenyl)methoxy]-N'-hydroxy-N,6-dimethyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide (PubChem CID 56665295) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methoxy]-N'-hydroxy-N,6-dimethyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide.
| Compound Name | 2-[(2-fluorophenyl)methoxy]-N'-hydroxy-N,6-dimethyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56665295 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[(2-fluorophenyl)methoxy]-N'-hydroxy-N,6-dimethyl-N-(pyridin-3-ylmethyl)pyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/O)N(C)Cc2cccnc2)c(OCc2ccccc2F)n1 |
| InChI | InChI=1S/C21H21FN4O2/c1-15-9-10-18(20(25-27)26(2)13-16-6-5-11-23-12-16)21(24-15)28-14-17-7-3-4-8-19(17)22/h3-12,27H,13-14H2,1-2H3/b25-20- |
| InChIKey | MXOJNPZEMSGCIU-QQTULTPQSA-N |
| XLogP | 3.77 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|