C23H34N6O2 — CID 56659190
2-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-4-(2-methylpropylamino)pyrimidine-5-carboxamide (PubChem CID 56659190) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-4-(2-methylpropylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-4-(2-methylpropylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56659190 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-(2-methoxyethyl)-4-(2-methylpropylamino)pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1cnc(N2CCN(Cc3ccccc3)CC2)nc1NCC(C)C |
| InChI | InChI=1S/C23H34N6O2/c1-18(2)15-25-21-20(22(30)24-9-14-31-3)16-26-23(27-21)29-12-10-28(11-13-29)17-19-7-5-4-6-8-19/h4-8,16,18H,9-15,17H2,1-3H3,(H,24,30)(H,25,26,27) |
| InChIKey | NZLJVDWKLQJNNU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|