C22H18N4O3S — CID 56659817
N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]benzamide (PubChem CID 56659817) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]benzamide.
| Compound Name | N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 56659817 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[5-[3-(benzenesulfonamido)phenyl]-1H-pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1cc(-c2cccc(NS(=O)(=O)c3ccccc3)c2)[nH]n1)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O3S/c27-22(16-8-3-1-4-9-16)23-21-15-20(24-25-21)17-10-7-11-18(14-17)26-30(28,29)19-12-5-2-6-13-19/h1-15,26H,(H2,23,24,25,27) |
| InChIKey | WZFLZUYBXNOPEA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |