C18H24N2O2 — CID 56662457
N-[[2-(3-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]cyclohexanamine (PubChem CID 56662457) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-[[2-(3-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]cyclohexanamine.
| Compound Name | N-[[2-(3-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 56662457 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-[[2-(3-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]cyclohexanamine |
| SMILES | CCOc1cccc(-c2nc(CNC3CCCCC3)co2)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-2-21-17-10-6-7-14(11-17)18-20-16(13-22-18)12-19-15-8-4-3-5-9-15/h6-7,10-11,13,15,19H,2-5,8-9,12H2,1H3 |
| InChIKey | DWEUOPCEXFGJEN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |