C17H20N2O2 — CID 56672741
4-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(3-ethoxyphenyl)-1,3-oxazole (PubChem CID 56672741) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(3-ethoxyphenyl)-1,3-oxazole.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(3-ethoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 56672741 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(3-ethoxyphenyl)-1,3-oxazole |
| SMILES | CCOc1cccc(-c2nc(CN3CC=CCC3)co2)c1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-20-16-8-6-7-14(11-16)17-18-15(13-21-17)12-19-9-4-3-5-10-19/h3-4,6-8,11,13H,2,5,9-10,12H2,1H3 |
| InChIKey | RVKGUUHRRZHMEX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|