C21H20F3N3O — CID 56662912
2-(3-ethyl-5-methyl-2-phenylimidazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide (PubChem CID 56662912) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is 2-(3-ethyl-5-methyl-2-phenylimidazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide.
| Compound Name | 2-(3-ethyl-5-methyl-2-phenylimidazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 56662912 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-(3-ethyl-5-methyl-2-phenylimidazol-4-yl)-N-[(2,3,4-trifluorophenyl)methyl]acetamide |
| SMILES | CCn1c(-c2ccccc2)nc(C)c1CC(=O)NCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H20F3N3O/c1-3-27-17(13(2)26-21(27)14-7-5-4-6-8-14)11-18(28)25-12-15-9-10-16(22)20(24)19(15)23/h4-10H,3,11-12H2,1-2H3,(H,25,28) |
| InChIKey | USMUJOYBPMHEPX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|