C21H22FN5O4 — CID 56665085
8-amino-7-fluoro-3,3-dimethyl-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (PubChem CID 56665085) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is 8-amino-7-fluoro-3,3-dimethyl-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid.
| Compound Name | 8-amino-7-fluoro-3,3-dimethyl-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 56665085 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 8-amino-7-fluoro-3,3-dimethyl-10-oxo-6-[2-(pyridin-2-ylamino)ethylamino]-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| SMILES | CC1(C)Cn2cc(C(=O)O)c(=O)c3c(N)c(F)c(NCCNc4ccccn4)c(c32)O1 |
| InChI | InChI=1S/C21H22FN5O4/c1-21(2)10-27-9-11(20(29)30)18(28)13-15(23)14(22)16(19(31-21)17(13)27)26-8-7-25-12-5-3-4-6-24-12/h3-6,9,26H,7-8,10,23H2,1-2H3,(H,24,25)(H,29,30) |
| InChIKey | VIIBSAKUAWPNFP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|