C19H15FN4O — CID 56668300
4-[[4-[(4-fluorophenyl)-hydroxymethyl]-5-methylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 56668300) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-[[4-[(4-fluorophenyl)-hydroxymethyl]-5-methylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(4-fluorophenyl)-hydroxymethyl]-5-methylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 56668300 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[[4-[(4-fluorophenyl)-hydroxymethyl]-5-methylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cnc(Nc2ccc(C#N)cc2)nc1C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H15FN4O/c1-12-11-22-19(23-16-8-2-13(10-21)3-9-16)24-17(12)18(25)14-4-6-15(20)7-5-14/h2-9,11,18,25H,1H3,(H,22,23,24) |
| InChIKey | BKWSZVLVDIRZKT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |