C20H28BrN3O — CID 56668504
(2S)-1-octyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide (PubChem CID 56668504) has the molecular formula C20H28BrN3O and a molecular weight of 406.37 g/mol. Its IUPAC name is (2S)-1-octyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide.
| Compound Name | (2S)-1-octyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 56668504 |
| Molecular Formula | C20H28BrN3O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (2S)-1-octyl-2-phenyl-3H-imidazo[1,2-a]pyrimidin-4-ium-2-ol bromide |
| SMILES | CCCCCCCCN1c2nccc[n+]2C[C@@]1(O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C20H28N3O.BrH/c1-2-3-4-5-6-10-16-23-19-21-14-11-15-22(19)17-20(23,24)18-12-8-7-9-13-18;/h7-9,11-15,24H,2-6,10,16-17H2,1H3;1H/q+1;/p-1/t20-;/m1./s1 |
| InChIKey | KBSRNVUQUVOCNG-VEIFNGETSA-M |
| XLogP | 0.40 |
| TPSA | 40.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|