C28H23N3O5S — CID 56669534
2-[6-cyano-1-(3-methylbenzoyl)naphthalen-2-yl]oxy-N-(2-methyl-4-sulfamoylphenyl)acetamide (PubChem CID 56669534) has the molecular formula C28H23N3O5S and a molecular weight of 513.58 g/mol. Its IUPAC name is 2-[6-cyano-1-(3-methylbenzoyl)naphthalen-2-yl]oxy-N-(2-methyl-4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[6-cyano-1-(3-methylbenzoyl)naphthalen-2-yl]oxy-N-(2-methyl-4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56669534 |
| Molecular Formula | C28H23N3O5S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-[6-cyano-1-(3-methylbenzoyl)naphthalen-2-yl]oxy-N-(2-methyl-4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cccc(C(=O)c2c(OCC(=O)Nc3ccc(S(N)(=O)=O)cc3C)ccc3cc(C#N)ccc23)c1 |
| InChI | InChI=1S/C28H23N3O5S/c1-17-4-3-5-21(12-17)28(33)27-23-9-6-19(15-29)14-20(23)7-11-25(27)36-16-26(32)31-24-10-8-22(13-18(24)2)37(30,34)35/h3-14H,16H2,1-2H3,(H,31,32)(H2,30,34,35) |
| InChIKey | LXZGTIJULPWVOL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |