C21H24N2O5 — CID 56670105
hexyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate (PubChem CID 56670105) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is hexyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate.
| Compound Name | hexyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate |
|---|---|
| PubChem CID | 56670105 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | hexyl 2-[[6-oxo-5-[(E)-3-oxobut-1-enyl]-1H-pyrimidin-4-yl]oxy]benzoate |
| SMILES | CCCCCCOC(=O)c1ccccc1Oc1nc[nH]c(=O)c1/C=C/C(C)=O |
| InChI | InChI=1S/C21H24N2O5/c1-3-4-5-8-13-27-21(26)16-9-6-7-10-18(16)28-20-17(12-11-15(2)24)19(25)22-14-23-20/h6-7,9-12,14H,3-5,8,13H2,1-2H3,(H,22,23,25)/b12-11+ |
| InChIKey | OCTCCMIASLEURU-VAWYXSNFSA-N |
| XLogP | 3.90 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|