C26H22ClN3O — CID 56672030
5-(3-chlorophenyl)imino-N,N-diethylbenzo[a]phenoxazin-9-amine (PubChem CID 56672030) has the molecular formula C26H22ClN3O and a molecular weight of 427.94 g/mol. Its IUPAC name is 5-(3-chlorophenyl)imino-N,N-diethylbenzo[a]phenoxazin-9-amine.
| Compound Name | 5-(3-chlorophenyl)imino-N,N-diethylbenzo[a]phenoxazin-9-amine |
|---|---|
| PubChem CID | 56672030 |
| Molecular Formula | C26H22ClN3O |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 5-(3-chlorophenyl)imino-N,N-diethylbenzo[a]phenoxazin-9-amine |
| SMILES | CCN(CC)c1ccc2nc3c4ccccc4/c(=N/c4cccc(Cl)c4)cc-3oc2c1 |
| InChI | InChI=1S/C26H22ClN3O/c1-3-30(4-2)19-12-13-22-24(15-19)31-25-16-23(28-18-9-7-8-17(27)14-18)20-10-5-6-11-21(20)26(25)29-22/h5-16H,3-4H2,1-2H3/b28-23+ |
| InChIKey | WUUFQFAILWMLIC-WEMUOSSPSA-N |
| XLogP | 6.82 |
| TPSA | 41.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|