C15H12Cl2N2O4 — CID 56673622
ethyl (E)-3-[4-(2,6-dichlorophenoxy)-6-oxo-1H-pyrimidin-5-yl]prop-2-enoate (PubChem CID 56673622) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is ethyl (E)-3-[4-(2,6-dichlorophenoxy)-6-oxo-1H-pyrimidin-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(2,6-dichlorophenoxy)-6-oxo-1H-pyrimidin-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 56673622 |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | ethyl (E)-3-[4-(2,6-dichlorophenoxy)-6-oxo-1H-pyrimidin-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(Oc2c(Cl)cccc2Cl)nc[nH]c1=O |
| InChI | InChI=1S/C15H12Cl2N2O4/c1-2-22-12(20)7-6-9-14(21)18-8-19-15(9)23-13-10(16)4-3-5-11(13)17/h3-8H,2H2,1H3,(H,18,19,21)/b7-6+ |
| InChIKey | RYFCZTSDUASCFB-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|