C26H33F3N2O5S — CID 56675196
tert-butyl N-[(2R,3S)-3-hydroxy-4-[(4R)-4-methyl-1,1-dioxo-7-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-1-phenylbutan-2-yl]carbamate (PubChem CID 56675196) has the molecular formula C26H33F3N2O5S and a molecular weight of 542.62 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-hydroxy-4-[(4R)-4-methyl-1,1-dioxo-7-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-hydroxy-4-[(4R)-4-methyl-1,1-dioxo-7-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 56675196 |
| Molecular Formula | C26H33F3N2O5S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-hydroxy-4-[(4R)-4-methyl-1,1-dioxo-7-(trifluoromethyl)-4,5-dihydro-3H-1λ6,2-benzothiazepin-2-yl]-1-phenylbutan-2-yl]carbamate |
| SMILES | C[C@@H]1Cc2cc(C(F)(F)F)ccc2S(=O)(=O)N(C[C@H](O)[C@@H](Cc2ccccc2)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H33F3N2O5S/c1-17-12-19-14-20(26(27,28)29)10-11-23(19)37(34,35)31(15-17)16-22(32)21(13-18-8-6-5-7-9-18)30-24(33)36-25(2,3)4/h5-11,14,17,21-22,32H,12-13,15-16H2,1-4H3,(H,30,33)/t17-,21-,22+/m1/s1 |
| InChIKey | QWMFVYCKBXHNBV-YHYVQYDKSA-N |
| XLogP | 4.39 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |