C21H28F3N5O3 — CID 66703878
tert-butyl N-[(2R,3R)-3-hydroxy-1-phenyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate (PubChem CID 66703878) has the molecular formula C21H28F3N5O3 and a molecular weight of 455.48 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-3-hydroxy-1-phenyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3R)-3-hydroxy-1-phenyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 66703878 |
| Molecular Formula | C21H28F3N5O3 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | tert-butyl N-[(2R,3R)-3-hydroxy-1-phenyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)[C@H](O)CN1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C21H28F3N5O3/c1-20(2,3)32-19(31)25-15(11-14-7-5-4-6-8-14)16(30)12-28-9-10-29-17(13-28)26-27-18(29)21(22,23)24/h4-8,15-16,30H,9-13H2,1-3H3,(H,25,31)/t15-,16-/m1/s1 |
| InChIKey | TXRUQOZHQSFCNS-HZPDHXFCSA-N |
| XLogP | 2.61 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |