C14H15N3O3 — CID 56675946
N'-hydroxy-2-(4-methoxyphenoxy)-6-methylpyridine-3-carboximidamide (PubChem CID 56675946) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N'-hydroxy-2-(4-methoxyphenoxy)-6-methylpyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-2-(4-methoxyphenoxy)-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56675946 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N'-hydroxy-2-(4-methoxyphenoxy)-6-methylpyridine-3-carboximidamide |
| SMILES | COc1ccc(Oc2nc(C)ccc2/C(N)=N/O)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-9-3-8-12(13(15)17-18)14(16-9)20-11-6-4-10(19-2)5-7-11/h3-8,18H,1-2H3,(H2,15,17) |
| InChIKey | MQLVRVFHBLWZJO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|