C9H13N3O2 — CID 76916350
2-ethoxy-N'-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 76916350) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-ethoxy-N'-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | 2-ethoxy-N'-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 76916350 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-ethoxy-N'-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | CCOc1nc(C)ccc1C(N)=NO |
| InChI | InChI=1S/C9H13N3O2/c1-3-14-9-7(8(10)12-13)5-4-6(2)11-9/h4-5,13H,3H2,1-2H3,(H2,10,12) |
| InChIKey | PGCNFDZYEQDYBO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|