C23H23F3N4O2S — CID 56676016
1-(benzenesulfonyl)-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine (PubChem CID 56676016) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine.
| Compound Name | 1-(benzenesulfonyl)-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 56676016 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[pyrazin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-amine |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(NC(c2ccc(C(F)(F)F)cc2)c2cnccn2)CC1 |
| InChI | InChI=1S/C23H23F3N4O2S/c24-23(25,26)18-8-6-17(7-9-18)22(21-16-27-12-13-28-21)29-19-10-14-30(15-11-19)33(31,32)20-4-2-1-3-5-20/h1-9,12-13,16,19,22,29H,10-11,14-15H2 |
| InChIKey | UVFJVTJCZDPIHA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |