C20H23N3O2S — CID 56678920
(NZ)-N-[(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-[6-methyl-2-(4-methylsulfanylphenoxy)-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 56678920) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is (NZ)-N-[(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-[6-methyl-2-(4-methylsulfanylphenoxy)-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-[6-methyl-2-(4-methylsulfanylphenoxy)-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56678920 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (NZ)-N-[(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-[6-methyl-2-(4-methylsulfanylphenoxy)-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | CSc1ccc(Oc2nc(C)ccc2/C(=N/O)N2C(C)C=CC2C)cc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-13-5-12-18(19(22-24)23-14(2)6-7-15(23)3)20(21-13)25-16-8-10-17(26-4)11-9-16/h5-12,14-15,24H,1-4H3/b22-19- |
| InChIKey | WWQNDRGZKVLVLS-QOCHGBHMSA-N |
| XLogP | 4.69 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|