C19H25N3O3 — CID 56679500
N-hydroxy-N'-[(3-methoxyphenyl)methyl]-6-methyl-2-(2-methylpropoxy)pyridine-3-carboximidamide (PubChem CID 56679500) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-hydroxy-N'-[(3-methoxyphenyl)methyl]-6-methyl-2-(2-methylpropoxy)pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-N'-[(3-methoxyphenyl)methyl]-6-methyl-2-(2-methylpropoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56679500 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-hydroxy-N'-[(3-methoxyphenyl)methyl]-6-methyl-2-(2-methylpropoxy)pyridine-3-carboximidamide |
| SMILES | COc1cccc(C/N=C(\NO)c2ccc(C)nc2OCC(C)C)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-13(2)12-25-19-17(9-8-14(3)21-19)18(22-23)20-11-15-6-5-7-16(10-15)24-4/h5-10,13,23H,11-12H2,1-4H3,(H,20,22) |
| InChIKey | MXLLYPCCDXHKPM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|