C21H21N3O4 — CID 56682818
N-hydroxy-6-(3-methoxyphenoxy)-N'-[(4-methoxyphenyl)methyl]pyridine-3-carboximidamide (PubChem CID 56682818) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-hydroxy-6-(3-methoxyphenoxy)-N'-[(4-methoxyphenyl)methyl]pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-6-(3-methoxyphenoxy)-N'-[(4-methoxyphenyl)methyl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56682818 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-hydroxy-6-(3-methoxyphenoxy)-N'-[(4-methoxyphenyl)methyl]pyridine-3-carboximidamide |
| SMILES | COc1ccc(C/N=C(\NO)c2ccc(Oc3cccc(OC)c3)nc2)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-26-17-9-6-15(7-10-17)13-23-21(24-25)16-8-11-20(22-14-16)28-19-5-3-4-18(12-19)27-2/h3-12,14,25H,13H2,1-2H3,(H,23,24) |
| InChIKey | YVSVENRUIWRTMX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|