C22H29N3O3 — CID 56675837
N-hydroxy-6-(3-methoxyphenoxy)-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide (PubChem CID 56675837) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-hydroxy-6-(3-methoxyphenoxy)-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-6-(3-methoxyphenoxy)-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56675837 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-hydroxy-6-(3-methoxyphenoxy)-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide |
| SMILES | COc1cccc(Oc2ccc(/C(=N/C3CC(C)CC(C)(C)C3)NO)cn2)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-15-10-17(13-22(2,3)12-15)24-21(25-26)16-8-9-20(23-14-16)28-19-7-5-6-18(11-19)27-4/h5-9,11,14-15,17,26H,10,12-13H2,1-4H3,(H,24,25) |
| InChIKey | XIIRYVUMDAAQBP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|