C21H25N3O2 — CID 56658958
N'-cyclopentyl-N-hydroxy-6-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pyridine-3-carboximidamide (PubChem CID 56658958) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N'-cyclopentyl-N-hydroxy-6-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pyridine-3-carboximidamide.
| Compound Name | N'-cyclopentyl-N-hydroxy-6-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56658958 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N'-cyclopentyl-N-hydroxy-6-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pyridine-3-carboximidamide |
| SMILES | ON/C(=N\C1CCCC1)c1ccc(Oc2cccc3c2CCCC3)nc1 |
| InChI | InChI=1S/C21H25N3O2/c25-24-21(23-17-8-2-3-9-17)16-12-13-20(22-14-16)26-19-11-5-7-15-6-1-4-10-18(15)19/h5,7,11-14,17,25H,1-4,6,8-10H2,(H,23,24) |
| InChIKey | SLRGTJHMUFCFJS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|