C21H27N3O2 — CID 11416907
6-[[7-(pentylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]pyridine-3-carboxamide (PubChem CID 11416907) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 6-[[7-(pentylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]pyridine-3-carboxamide.
| Compound Name | 6-[[7-(pentylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11416907 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 6-[[7-(pentylamino)-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]pyridine-3-carboxamide |
| SMILES | CCCCCNC1CCc2cccc(Oc3ccc(C(N)=O)cn3)c2C1 |
| InChI | InChI=1S/C21H27N3O2/c1-2-3-4-12-23-17-10-8-15-6-5-7-19(18(15)13-17)26-20-11-9-16(14-24-20)21(22)25/h5-7,9,11,14,17,23H,2-4,8,10,12-13H2,1H3,(H2,22,25) |
| InChIKey | PCGIMRQGRMSFQQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|