C19H25N3O2 — CID 68749693
6-[4-[1-(pentylamino)ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 68749693) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-[4-[1-(pentylamino)ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[1-(pentylamino)ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68749693 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 6-[4-[1-(pentylamino)ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | CCCCCNC(C)c1ccc(Oc2ccc(C(N)=O)cn2)cc1 |
| InChI | InChI=1S/C19H25N3O2/c1-3-4-5-12-21-14(2)15-6-9-17(10-7-15)24-18-11-8-16(13-22-18)19(20)23/h6-11,13-14,21H,3-5,12H2,1-2H3,(H2,20,23) |
| InChIKey | XTDMCQFAAXNVAL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|