C23H32FN3O2 — CID 68748468
6-[2-fluoro-4-[4-methyl-1-(pentylamino)pentyl]phenoxy]pyridine-3-carboxamide (PubChem CID 68748468) has the molecular formula C23H32FN3O2 and a molecular weight of 401.53 g/mol. Its IUPAC name is 6-[2-fluoro-4-[4-methyl-1-(pentylamino)pentyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[2-fluoro-4-[4-methyl-1-(pentylamino)pentyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68748468 |
| Molecular Formula | C23H32FN3O2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 6-[2-fluoro-4-[4-methyl-1-(pentylamino)pentyl]phenoxy]pyridine-3-carboxamide |
| SMILES | CCCCCNC(CCC(C)C)c1ccc(Oc2ccc(C(N)=O)cn2)c(F)c1 |
| InChI | InChI=1S/C23H32FN3O2/c1-4-5-6-13-26-20(10-7-16(2)3)17-8-11-21(19(24)14-17)29-22-12-9-18(15-27-22)23(25)28/h8-9,11-12,14-16,20,26H,4-7,10,13H2,1-3H3,(H2,25,28) |
| InChIKey | YVWBIVXSZNDHAT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|