C19H24BN2O2 — CID 71096910
CID 71096910 (PubChem CID 71096910) has the molecular formula C19H24BN2O2 and a molecular weight of 323.23 g/mol.
| Compound Name | CID 71096910 |
|---|---|
| PubChem CID | 71096910 |
| Molecular Formula | C19H24BN2O2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | — |
| SMILES | Cc1cc(C[B]CCC(C)C)ccc1Oc1ccc(C(N)=O)cn1 |
| InChI | InChI=1S/C19H24BN2O2/c1-13(2)8-9-20-11-15-4-6-17(14(3)10-15)24-18-7-5-16(12-22-18)19(21)23/h4-7,10,12-13H,8-9,11H2,1-3H3,(H2,21,23) |
| InChIKey | ULVXTTDEDVXAAV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|