C23H27N3O2 — CID 89168291
6-[2-methyl-4-[2-[(5-methylidenecyclohex-3-en-1-yl)methylamino]ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 89168291) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-[2-methyl-4-[2-[(5-methylidenecyclohex-3-en-1-yl)methylamino]ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[2-methyl-4-[2-[(5-methylidenecyclohex-3-en-1-yl)methylamino]ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89168291 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 6-[2-methyl-4-[2-[(5-methylidenecyclohex-3-en-1-yl)methylamino]ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | C=C1C=CCC(CNCCc2ccc(Oc3ccc(C(N)=O)cn3)c(C)c2)C1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-4-3-5-19(12-16)14-25-11-10-18-6-8-21(17(2)13-18)28-22-9-7-20(15-26-22)23(24)27/h3-4,6-9,13,15,19,25H,1,5,10-12,14H2,2H3,(H2,24,27) |
| InChIKey | QIYZJVBOMHGEJC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|