C25H34FN3O2 — CID 174451267
6-[4-(2-amino-1-cyclohexyl-5-methylhexan-2-yl)-2-fluorophenoxy]pyridine-3-carboxamide (PubChem CID 174451267) has the molecular formula C25H34FN3O2 and a molecular weight of 427.56 g/mol. Its IUPAC name is 6-[4-(2-amino-1-cyclohexyl-5-methylhexan-2-yl)-2-fluorophenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-(2-amino-1-cyclohexyl-5-methylhexan-2-yl)-2-fluorophenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174451267 |
| Molecular Formula | C25H34FN3O2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 6-[4-(2-amino-1-cyclohexyl-5-methylhexan-2-yl)-2-fluorophenoxy]pyridine-3-carboxamide |
| SMILES | CC(C)CCC(N)(CC1CCCCC1)c1ccc(Oc2ccc(C(N)=O)cn2)c(F)c1 |
| InChI | InChI=1S/C25H34FN3O2/c1-17(2)12-13-25(28,15-18-6-4-3-5-7-18)20-9-10-22(21(26)14-20)31-23-11-8-19(16-29-23)24(27)30/h8-11,14,16-18H,3-7,12-13,15,28H2,1-2H3,(H2,27,30) |
| InChIKey | XXNAYWONGGPMAG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |