C17H15F4N3O3 — CID 56672713
N-hydroxy-N'-(oxolan-2-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide (PubChem CID 56672713) has the molecular formula C17H15F4N3O3 and a molecular weight of 385.32 g/mol. Its IUPAC name is N-hydroxy-N'-(oxolan-2-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-N'-(oxolan-2-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56672713 |
| Molecular Formula | C17H15F4N3O3 |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-hydroxy-N'-(oxolan-2-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
| SMILES | ON/C(=N\CC1CCCO1)c1ccc(Oc2c(F)c(F)cc(F)c2F)nc1 |
| InChI | InChI=1S/C17H15F4N3O3/c18-11-6-12(19)15(21)16(14(11)20)27-13-4-3-9(7-22-13)17(24-25)23-8-10-2-1-5-26-10/h3-4,6-7,10,25H,1-2,5,8H2,(H,23,24) |
| InChIKey | IESOAUGVUZTNQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|