C12H15ClO — CID 11310357
5-(2-chloroethoxy)-1,2,3,4-tetrahydronaphthalene (PubChem CID 11310357) has the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. Its IUPAC name is 5-(2-chloroethoxy)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(2-chloroethoxy)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 11310357 |
| Molecular Formula | C12H15ClO |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-(2-chloroethoxy)-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClCCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C12H15ClO/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7H,1-2,4,6,8-9H2 |
| InChIKey | GZMPZSMDKRBPFK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|