C16H22O3 — CID 112511655
2-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentanoic acid (PubChem CID 112511655) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentanoic acid.
| Compound Name | 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentanoic acid |
|---|---|
| PubChem CID | 112511655 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-methyl-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentanoic acid |
| SMILES | CC(CCCOc1cccc2c1CCCC2)C(=O)O |
| InChI | InChI=1S/C16H22O3/c1-12(16(17)18)6-5-11-19-15-10-4-8-13-7-2-3-9-14(13)15/h4,8,10,12H,2-3,5-7,9,11H2,1H3,(H,17,18) |
| InChIKey | UTFUIDGANOQFIJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|