C12H15NO3 — CID 19855453
2-amino-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetic acid (PubChem CID 19855453) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-amino-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetic acid.
| Compound Name | 2-amino-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetic acid |
|---|---|
| PubChem CID | 19855453 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-amino-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)acetic acid |
| SMILES | NC(Oc1cccc2c1CCCC2)C(=O)O |
| InChI | InChI=1S/C12H15NO3/c13-11(12(14)15)16-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6,13H2,(H,14,15) |
| InChIKey | XHDOCNXGQVLCJS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|