C15H23NO2 — CID 112508761
1-amino-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentan-3-ol (PubChem CID 112508761) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-amino-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentan-3-ol.
| Compound Name | 1-amino-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentan-3-ol |
|---|---|
| PubChem CID | 112508761 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-amino-5-(5,6,7,8-tetrahydronaphthalen-1-yloxy)pentan-3-ol |
| SMILES | NCCC(O)CCOc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H23NO2/c16-10-8-13(17)9-11-18-15-7-3-5-12-4-1-2-6-14(12)15/h3,5,7,13,17H,1-2,4,6,8-11,16H2 |
| InChIKey | WTKXTWKVRAJRFR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |