C18H12F4N4O2 — CID 56668982
N-hydroxy-N'-(pyridin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide (PubChem CID 56668982) has the molecular formula C18H12F4N4O2 and a molecular weight of 392.31 g/mol. Its IUPAC name is N-hydroxy-N'-(pyridin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide.
| Compound Name | N-hydroxy-N'-(pyridin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56668982 |
| Molecular Formula | C18H12F4N4O2 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-hydroxy-N'-(pyridin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenoxy)pyridine-3-carboximidamide |
| SMILES | ON/C(=N\Cc1ccncc1)c1ccc(Oc2c(F)c(F)cc(F)c2F)nc1 |
| InChI | InChI=1S/C18H12F4N4O2/c19-12-7-13(20)16(22)17(15(12)21)28-14-2-1-11(9-24-14)18(26-27)25-8-10-3-5-23-6-4-10/h1-7,9,27H,8H2,(H,25,26) |
| InChIKey | JTVKEGWDFOHSCI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|